CAS 91496-98-9
:2-(2,3-dihydro-1H-inden-5-yloxy)propanoic acid
Description:
2-(2,3-Dihydro-1H-inden-5-yloxy)propanoic acid, with the CAS number 91496-98-9, is an organic compound characterized by its unique structure that includes an indene derivative and a propanoic acid moiety. This compound features a dihydroindene ring system, which contributes to its potential biological activity and chemical reactivity. The presence of the propanoic acid functional group indicates that it can exhibit acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. Additionally, the ether linkage (the -O- connecting the indene and propanoic acid) suggests that it may have interesting solubility characteristics and could interact with biological systems. The compound's structural features may also influence its pharmacological properties, making it a candidate for research in medicinal chemistry. Overall, 2-(2,3-dihydro-1H-inden-5-yloxy)propanoic acid is a compound of interest due to its potential applications in pharmaceuticals and organic synthesis.
Formula:C12H14O3
InChI:InChI=1/C12H14O3/c1-8(12(13)14)15-11-6-5-9-3-2-4-10(9)7-11/h5-8H,2-4H2,1H3,(H,13,14)
SMILES:CC(C(=O)O)Oc1ccc2CCCc2c1
Synonyms:- Propanoic acid, 2-[(2,3-dihydro-1H-inden-5-yl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
