CymitQuimica logo

CAS 91498-79-2

:

6-chloro-4-methoxy-naphthalene-2-carboxylic acid

Description:
6-Chloro-4-methoxy-naphthalene-2-carboxylic acid is an organic compound characterized by its naphthalene backbone, which features a chlorine atom and a methoxy group as substituents. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. This compound is typically a solid at room temperature and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the naphthalene structure. The chlorine atom introduces a degree of electronegativity, potentially influencing the compound's reactivity and interactions with other molecules. The methoxy group can also affect the compound's electronic properties and steric hindrance. Overall, 6-chloro-4-methoxy-naphthalene-2-carboxylic acid is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules.
Formula:C12H9ClO3
InChI:InChI=1/C12H9ClO3/c1-16-11-5-8(12(14)15)4-7-2-3-9(13)6-10(7)11/h2-6H,1H3,(H,14,15)
Synonyms:
  • 6-chloro-4-methoxy-2-naphthoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.