
CAS 914988-11-7
:1,1-Dimethylethyl 3-cyano-3-methyl-4-oxo-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 3-cyano-3-methyl-4-oxo-1-piperidinecarboxylate, identified by its CAS number 914988-11-7, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a cyano group (-CN) and a carbonyl group (C=O) within its structure, contributing to its reactivity and potential applications in organic synthesis. The dimethyl group attached to the piperidine enhances its steric properties, influencing its interaction with other molecules. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a unique structure that may serve as a building block in the development of more complex chemical entities.
Formula:C12H18N2O3
InChI:InChI=1S/C12H18N2O3/c1-11(2,3)17-10(16)14-6-5-9(15)12(4,7-13)8-14/h5-6,8H2,1-4H3
InChI key:InChIKey=KGDSEJVFBRXIPV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(C#N)(C)C(=O)CC1
Synonyms:- 1,1-Dimethylethyl 3-cyano-3-methyl-4-oxo-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 3-cyano-3-methyl-4-oxo-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.