CAS 915019-52-2
:2-[4-[(3-amino-6-bromo-4-quinolyl)amino]phenyl]-2-methyl-propanenitrile
Description:
2-[4-[(3-amino-6-bromo-4-quinolyl)amino]phenyl]-2-methyl-propanenitrile, with the CAS number 915019-52-2, is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a nitrile functional group. This compound features a branched aliphatic chain with a nitrile (-C≡N) group, contributing to its potential reactivity and solubility properties. The presence of the amino group and bromine atom in the quinoline ring suggests that it may exhibit biological activity, possibly as a pharmaceutical agent or in medicinal chemistry applications. The compound's molecular structure indicates potential for hydrogen bonding and interactions with biological targets, which could influence its pharmacokinetic and pharmacodynamic properties. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in various chemical and biological contexts. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and research.
Formula:C19H17BrN4
InChI:InChI=1/C19H17BrN4/c1-19(2,11-21)12-3-6-14(7-4-12)24-18-15-9-13(20)5-8-17(15)23-10-16(18)22/h3-10H,22H2,1-2H3,(H,23,24)
SMILES:CC(C)(C#N)c1ccc(cc1)N=c1c2cc(ccc2[nH]cc1N)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(4-((3-Amino-6-bromoquinolin-4-yl)amino)phenyl)-2-methylpropanenitrile
CAS:Formula:C19H17BrN4Color and Shape:SolidMolecular weight:381.26912-(4-((3-Amino-6-bromoquinolin-4-yl)amino)-phenyl)-2-methylpropanenitrile
CAS:Controlled ProductApplications 2-(4-((3-Amino-6-bromoquinolin-4-yl)amino)-phenyl)-2-methylpropanenitrile is used as a reagent in the preparation of imidazo quinoline derivatives, compounds that act as mammalian target of rapamycin (mTOR) an phosphatidylinositol 3-kinase (PI3K-kinase) inhibitors.
References Li, X., et al. Imidazo Quinoline Derivative as mTOR and PI3K-kinase Inhibitor Useful In the Treatment of Various Diseases, and Its Preparation. PCT Int. Appl. 2013053273. Apr 18, 2013.Formula:C19H17BrN4Color and Shape:NeatMolecular weight:381.27

