CymitQuimica logo

CAS 915030-08-9

:

2-(trifluoromethyl)thiazole-4-carboxylic acid

Description:
2-(Trifluoromethyl)thiazole-4-carboxylic acid is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The trifluoromethyl group (-CF3) attached to the thiazole enhances the compound's lipophilicity and can influence its biological activity. The carboxylic acid functional group (-COOH) contributes to its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. This compound is often studied for its potential pharmaceutical properties, particularly in the development of agrochemicals and medicinal compounds. Its unique structure allows for diverse reactivity, including potential interactions with biological targets. Additionally, the presence of fluorine atoms can impart unique electronic properties, making it a subject of interest in materials science and medicinal chemistry. Overall, 2-(trifluoromethyl)thiazole-4-carboxylic acid is a versatile compound with significant implications in various fields of research.
Formula:C5H2F3NO2S
InChI:InChI=1/C5H2F3NO2S/c6-5(7,8)4-9-2(1-12-4)3(10)11/h1H,(H,10,11)
InChI key:KPPCPQREZHKKRA-UHFFFAOYSA-N
SMILES:c1c(C(=O)O)nc(C(F)(F)F)s1
Found 4 products.