CAS 91505-18-9

5-[2-(1H-imidazol-1-yl)ethoxy]thiophene-2-carboxylic acid hydrochloride (1:1)

Description:

5-[2-(1H-imidazol-1-yl)ethoxy]thiophene-2-carboxylic acid hydrochloride is a chemical compound characterized by its unique structure, which includes a thiophene ring, an imidazole moiety, and a carboxylic acid functional group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions. The presence of the thiophene ring contributes to its potential applications in organic electronics and pharmaceuticals, while the imidazole group may impart biological activity, making it of interest in medicinal chemistry. The carboxylic acid functionality can participate in various chemical reactions, including esterification and amidation, and can also influence the compound's acidity and reactivity. The hydrochloride form often stabilizes the compound and improves its handling properties. Overall, this compound's characteristics suggest potential utility in drug development and materials science, although specific applications would depend on further research into its biological and chemical properties.

Formula: C₁₀H₁₀N₂O₃S·ClH

InChI: InChI=1/C10H10N2O3S.ClH/c13-10(14)8-1-2-9(16-8)15-6-5-12-4-3-11-7-12;/h1-4,7H,5-6H2,(H,13,14);1H

Synonyms:

• LG 82-4-00

LG 82-4-00

CAS: 91505-18-9

LG 82-4-00 is an inhibitor of thromboxane.

Formula: C₁₀H₁₁ClN₂O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 274.72

Ref: TM-T25709