CAS 91505-26-9

1-(5-Chloro-4-methyl-2-thienyl)ethanone

Description:

1-(5-Chloro-4-methyl-2-thienyl)ethanone, with the CAS number 91505-26-9, is an organic compound characterized by its thienyl structure, which incorporates a thiophene ring with a chlorine substituent and a methyl group. This compound features a ketone functional group, specifically an ethanone moiety, indicating the presence of a carbonyl group (C=O) adjacent to an ethyl group. The chlorine atom contributes to its reactivity and potential biological activity, while the methyl group can influence its steric and electronic properties. The thienyl ring enhances the compound's aromatic characteristics, potentially affecting its solubility and interaction with other molecules. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features that could impart specific biological activities or chemical reactivity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups.

Formula: C₇H₇ClOS

InChI: InChI=1S/C7H7ClOS/c1-4-3-6(5(2)9)10-7(4)8/h3H,1-2H3

InChI key: InChIKey=ROMCXPKYPGODDM-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC(C)=C(Cl)S1

Synonyms:

• 1-(5-Chloro-4-methyl-2-thienyl)ethanone
• Ethanone, 1-(5-chloro-4-methyl-2-thienyl)-
• 1-(5-Chloro-4-methylthiophen-2-yl)ethanone