CymitQuimica logo

CAS 91506-06-8

:

3-Iodo-N,N-dimethylbenzamide

Description:
3-Iodo-N,N-dimethylbenzamide is an organic compound characterized by the presence of an amide functional group attached to a benzene ring, which is further substituted with an iodine atom at the meta position relative to the amide group. This compound features a dimethyl group on the nitrogen atom of the amide, contributing to its overall structure and properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic ring and polar amide group. The presence of the iodine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may have applications in medicinal chemistry and material science, owing to the unique properties imparted by the iodine substituent and the dimethylamino group. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Iodo-N,N-dimethylbenzamide is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C9H10INO
InChI:InChI=1S/C9H10INO/c1-11(2)9(12)7-4-3-5-8(10)6-7/h3-6H,1-2H3
InChI key:InChIKey=XSLDOPYONMGECY-UHFFFAOYSA-N
SMILES:C(N(C)C)(=O)C1=CC(I)=CC=C1
Synonyms:
  • Benzamide, 3-iodo-N,N-dimethyl-
  • N,N-Dimethyl-3-iodobenzamide
  • 3-Iodo-N,N-dimethylbenzamide
Found 4 products.