CymitQuimica logo

CAS 915087-26-2

:

4-[(1-Cyanocyclobutyl)amino]-2-fluoro-N-methylbenzamide

Description:
4-[(1-Cyanocyclobutyl)amino]-2-fluoro-N-methylbenzamide, identified by its CAS number 915087-26-2, is a chemical compound that features a complex molecular structure. It contains a benzamide core substituted with a fluorine atom and a cyanocyclobutyl group linked through an amino functional group. This compound is characterized by its potential biological activity, which may include interactions with specific receptors or enzymes, making it of interest in medicinal chemistry and drug development. The presence of the fluorine atom often enhances the compound's metabolic stability and lipophilicity, which can influence its pharmacokinetic properties. Additionally, the cyanocyclobutyl moiety may contribute to the compound's overall three-dimensional shape, affecting its binding affinity and selectivity towards biological targets. As with many synthetic organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound exemplifies the intricate design often employed in the development of pharmaceuticals.
Formula:C13H14FN3O
InChI:InChI=1S/C13H14FN3O/c1-16-12(18)10-4-3-9(7-11(10)14)17-13(8-15)5-2-6-13/h3-4,7,17H,2,5-6H2,1H3,(H,16,18)
InChI key:InChIKey=AAIGLIMPDRXLFW-UHFFFAOYSA-N
SMILES:N(C1(C#N)CCC1)C2=CC(F)=C(C(NC)=O)C=C2
Synonyms:
  • 4-[(1-Cyanocyclobutyl)amino]-2-fluoro-N-methylbenzamide
  • N-Methyl-4-(1-cyanocyclobutylamino)-2-fluorobenzamide
  • Benzamide, 4-[(1-cyanocyclobutyl)amino]-2-fluoro-N-methyl-
Found 6 products.