CAS 915095-86-2

(2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone

Description:

(2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple halogen substituents. The presence of chlorine, iodine, and fluorine atoms contributes to its unique chemical properties, such as increased reactivity and potential for various interactions in chemical reactions. This compound typically exhibits a solid state at room temperature and may have moderate solubility in organic solvents due to its aromatic nature. The halogen substituents can influence the compound's electronic properties, potentially affecting its reactivity in nucleophilic substitution reactions or its behavior in electrophilic aromatic substitution. Additionally, the presence of multiple aromatic rings may enhance its stability and influence its interactions with biological systems, making it of interest in medicinal chemistry and material science. Overall, (2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₃H₇ClFIO

InChI: InChI=1S/C13H7ClFIO/c14-12-6-5-10(16)7-11(12)13(17)8-1-3-9(15)4-2-8/h1-7H

InChI key: InChIKey=KNYGUQLVFSPVRI-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC(I)=C1)C2=CC=C(F)C=C2

Synonyms:

• Methanone, (2-chloro-5-iodophenyl)(4-fluorophenyl)-
• (2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone

Empagliflozin Impurity 59

CAS: 915095-86-2

Formula: C₁₃H₇ClFIO

Molecular weight: 360.55

Ref: ST-EA-CP-E7074

(2-chloro-5-iodophenyl)-(4-fluorophenyl)methanone

CAS: 915095-86-2

Formula: C₁₃H₇ClFIO

Purity: 97%

Color and Shape: Solid

Molecular weight: 360.5500

Ref: IN-DA00IGQK

(2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone

CAS: 915095-86-2

(2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone

Purity: 98%

Molecular weight: 360.55g/mol

Ref: 54-PC540099

Empagliflozin Impurity 45

CAS: 915095-86-2

Formula: C₁₃H₇ClFIO

Molecular weight: 360.55

Ref: 4Z-E-6360

(2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone

CAS: 915095-86-2

Formula: C₁₃H₇ClFIO

Purity: 98%

Color and Shape: Solid

Molecular weight: 360.55

Ref: 10-F463014

(2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone

Controlled Product

CAS: 915095-86-2

Applications (2-Chloro-5-iodophenyl)(4-fluorophenyl)methanone is a reagent in the synthesis of Empagliflozin (E521510); an inhibitor of SGLT-2.
References Wang, X., et al.: Org. Lett., 16, 4090 (2014)

Formula: C₁₃H₇ClFIO

Color and Shape: Neat

Molecular weight: 360.55

Ref: TR-C368575