CAS 915132-91-1

[2-[(6-Bromohexyl)oxy]-1,1-difluoroethyl]benzene

Description:

[2-[(6-Bromohexyl)oxy]-1,1-difluoroethyl]benzene, with the CAS number 915132-91-1, is an organic compound characterized by its complex structure that includes a benzene ring substituted with a difluoroethyl group and a bromoalkyl ether. The presence of the difluoroethyl group suggests that the compound may exhibit unique electronic properties and potential reactivity due to the electronegative fluorine atoms. The bromohexyl moiety indicates that the compound has a relatively long hydrophobic carbon chain, which may influence its solubility and interaction with biological systems. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a building block for more complex molecules. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific interactions between the functional groups and the overall molecular structure. Safety and handling precautions should be observed, as the presence of bromine and fluorine can indicate potential toxicity or environmental concerns.

Formula: C₁₄H₁₉BrF₂O

InChI: InChI=1S/C14H19BrF2O/c15-10-6-1-2-7-11-18-12-14(16,17)13-8-4-3-5-9-13/h3-5,8-9H,1-2,6-7,10-12H2

InChI key: InChIKey=GIFRBSZGUWVTHT-UHFFFAOYSA-N

SMILES: C(COCCCCCCBr)(F)(F)C1=CC=CC=C1

Synonyms:

• Benzene, [2-[(6-bromohexyl)oxy]-1,1-difluoroethyl]-
• [2-[(6-Bromohexyl)oxy]-1,1-difluoroethyl]benzene