
CAS 915132-93-3
:6-(2,2-Difluoro-2-phenylethoxy)-1-hexanamine
Description:
6-(2,2-Difluoro-2-phenylethoxy)-1-hexanamine, with the CAS number 915132-93-3, is a chemical compound characterized by its unique structure that includes a hexanamine backbone and a difluorophenylethoxy substituent. This compound features a hexane chain with an amine functional group at one end, which can influence its reactivity and solubility properties. The presence of the difluorophenyl group introduces significant steric and electronic effects, potentially enhancing its biological activity or interaction with other molecules. The difluoromethyl groups can also impart unique properties such as increased lipophilicity and altered hydrogen bonding capabilities. This compound may be of interest in medicinal chemistry and drug development due to its potential pharmacological properties. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization. As with any chemical substance, safety data and handling precautions should be consulted before use.
Formula:C14H21F2NO
InChI:InChI=1S/C14H21F2NO/c15-14(16,13-8-4-3-5-9-13)12-18-11-7-2-1-6-10-17/h3-5,8-9H,1-2,6-7,10-12,17H2
InChI key:InChIKey=ZAVGLNVUWHAKNQ-UHFFFAOYSA-N
SMILES:C(COCCCCCCN)(F)(F)C1=CC=CC=C1
Synonyms:- 6-(2,2-Difluoro-2-phenylethoxy)-1-hexanamine
- [6-(2,2-Difluoro-2-phenylethoxy)hexyl]amine
- 1-Hexanamine, 6-(2,2-difluoro-2-phenylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.