CymitQuimica logo

CAS 915140-72-6

:

4-Pyrimidinecarboxylic acid, 6-methyl-2-(methylamino)-

Description:
4-Pyrimidinecarboxylic acid, 6-methyl-2-(methylamino)-, also known by its CAS number 915140-72-6, is an organic compound characterized by a pyrimidine ring substituted with a carboxylic acid and a methylamino group. This compound features a pyrimidine structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of the carboxylic acid group (-COOH) contributes to its acidic properties, while the methylamino group (-NH(CH3)2) enhances its basicity and potential for forming hydrogen bonds. The methyl substitution at the 6-position of the pyrimidine ring can influence the compound's solubility and reactivity. Typically, such compounds may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for various interactions, which can be explored in drug design and synthesis. Overall, this compound's unique functional groups and structural features contribute to its potential applications in medicinal chemistry and related fields.
Formula:C7H9N3O2
InChI:InChI=1S/C7H9N3O2/c1-4-3-5(6(11)12)10-7(8-2)9-4/h3H,1-2H3,(H,11,12)(H,8,9,10)
InChI key:QOSQKVPPODILND-UHFFFAOYSA-N
SMILES:CC1=CC(=NC(=N1)NC)C(=O)O
Found 2 products.