CAS 91516-28-8
:1-(1,3-thiazol-5-yl)ethanone
Description:
1-(1,3-thiazol-5-yl)ethanone, with the CAS number 91516-28-8, is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an ethanone functional group, indicating the presence of a carbonyl group (C=O) adjacent to an ethyl group. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its chemical properties include reactivity towards nucleophiles due to the electrophilic nature of the carbonyl carbon. Additionally, 1-(1,3-thiazol-5-yl)ethanone may participate in various chemical reactions, such as condensation and substitution, making it a versatile intermediate in organic synthesis. Its unique structure and functional groups suggest potential applications in medicinal chemistry and material science.
Formula:C5H5NOS
InChI:InChI=1/C5H5NOS/c1-4(7)5-2-6-3-8-5/h2-3H,1H3
SMILES:CC(=O)c1cncs1
Synonyms:- Ethanone, 1-(5-thiazolyl)-
- 1-(1,3-Thiazol-5-yl)ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethanone, 1-(5-thiazolyl)- (9CI)
CAS:Formula:C5H5NOSPurity:98%Color and Shape:SolidMolecular weight:127.16431-Thiazol-5-yl-ethanone
CAS:Formula:C5H5NOSPurity:98%Color and Shape:Yellow crystalline powderMolecular weight:127.161-(5-Thiazolyl)ethanone
CAS:1-(5-Thiazolyl)ethanone is an antimicrobial agent that has been shown to be active against staphylococcus and other bacteria. It is a nucleophilic reagent that reacts with the amine group of amino acids in proteins, which leads to the formation of protein adducts. 1-(5-Thiazolyl)ethanone has been found to be safe for use in humans and animals and does not have any significant side effects. The chemical is also able to kill cancer cells by inhibiting DNA synthesis, RNA synthesis, and protein synthesis. This drug has been shown to have antibacterial activity against a number of different bacterial strains, including methicillin-resistant Staphylococcus aureus (MRSA) isolates.Formula:C5H5NOSPurity:Min. 95%Molecular weight:127.16 g/mol



