CymitQuimica logo

CAS 91516-29-9

:

Phenyl-5-thiazolylmethanone

Description:
Phenyl-5-thiazolylmethanone, identified by its CAS number 91516-29-9, is an organic compound characterized by the presence of a thiazole ring and a phenyl group. This compound typically exhibits a yellow to brownish color and is known for its potential applications in pharmaceuticals and organic synthesis. The thiazole moiety contributes to its biological activity, often acting as a pharmacophore in various medicinal compounds. It is generally soluble in organic solvents, such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. The compound's structure allows for various chemical reactions, including nucleophilic substitutions and electrophilic additions, making it a versatile intermediate in synthetic chemistry. Additionally, its stability under standard laboratory conditions makes it suitable for further functionalization. As with many thiazole derivatives, it may exhibit antimicrobial or antifungal properties, although specific biological activities would depend on the context of its use and the presence of other functional groups. Proper handling and safety measures should be observed due to potential toxicity associated with thiazole derivatives.
Formula:C10H7NOS
InChI:InChI=1S/C10H7NOS/c12-10(9-6-11-7-13-9)8-4-2-1-3-5-8/h1-7H
InChI key:InChIKey=OOUPXTAVGLSKRS-UHFFFAOYSA-N
SMILES:C(=O)(C1=CN=CS1)C2=CC=CC=C2
Synonyms:
  • Methanone, phenyl-5-thiazolyl-
  • Phenyl-5-thiazolylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.