CAS 91520-00-2
:8-methoxy-2H-chromen-3(4H)-one
Description:
8-Methoxy-2H-chromen-3(4H)-one, also known as 8-methoxyflavone, is a synthetic compound belonging to the flavonoid class of chemicals. It features a chromone backbone, characterized by a benzopyran structure, with a methoxy group (-OCH3) attached at the 8-position. This compound is typically a yellow to orange crystalline solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but has limited solubility in water. 8-Methoxy-2H-chromen-3(4H)-one exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Its mechanism of action may involve modulation of signaling pathways and inhibition of specific enzymes. The compound is also studied for its potential applications in food and cosmetic industries due to its stability and beneficial properties. As with many flavonoids, it may contribute to health benefits associated with dietary intake of plant-based foods.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c1-12-9-4-2-3-7-5-8(11)6-13-10(7)9/h2-4H,5-6H2,1H3
SMILES:COc1cccc2CC(=O)COc12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
8-Methoxychroman-3-one
CAS:8-Methoxychroman-3-one is a carboxylic acid that has been chemically modified to contain an acrylonitrile group. It can be synthesized by the reaction of nitric acid and glycidyl methacrylate. 8-Methoxychroman-3-one is used as a building block in organic synthesis. It is also used as a precursor for the production of other chemicals, such as dyes and pharmaceuticals. This compound can be converted to optically active forms by reacting with an optically active amine such as (S)-(-)-2-(tert-butyldimethylsilyl)azide or (R)-(+)-2-(tert-butyldimethylsilyl)azide. 8-Methoxychroman-3-one can be hydrolyzed with an aluminum alkoxide to produce glycidol, which is used in the production of polyurethFormula:C10H10O3Purity:Min. 95%Molecular weight:178.18 g/mol
