CymitQuimica logo

CAS 915226-43-6

:

1-Piperidinecarboxylicacid, 3-(aminocarbonyl)-, 1,1-dimethylethyl ester, (3R)-

Description:
1-Piperidinecarboxylic acid, 3-(aminocarbonyl)-, 1,1-dimethylethyl ester, (3R)-, with CAS number 915226-43-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid derivative with an ester functional group, specifically an isopropyl ester, indicating the presence of a tert-butyl group. The (3R)- designation indicates that the compound has a specific stereochemistry at the carbon atom adjacent to the nitrogen in the piperidine ring, which can influence its biological activity and interactions. The presence of the aminocarbonyl group suggests potential reactivity and applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit properties such as solubility in polar solvents and potential interactions with biological targets due to its functional groups. Overall, its unique structure and functionalization make it a compound of interest in various chemical and pharmaceutical research contexts.
Formula:C11H20N2O3
InChI:InChI=1S/C11H20N2O3/c1-11(2,3)16-10(15)13-6-4-5-8(7-13)9(12)14/h8H,4-7H2,1-3H3,(H2,12,14)/t8-/m1/s1
InChI key:APFUDGDIIFSTSD-MRVPVSSYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC[C@H](C1)C(=O)N
Synonyms:
  • (R)-1-(tert-Butoxycarbonyl)nipecotamide
Found 4 products.