CymitQuimica logo

CAS 91523-50-1

:

6-Hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid

Description:
6-Hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, with the CAS number 91523-50-1, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance features a tetrahydroisoquinoline core, which is a bicyclic structure characterized by a fused benzene and piperidine ring. The presence of a hydroxyl group at the 6-position and a carboxylic acid functional group at the 1-position contributes to its chemical reactivity and potential biological activity. The compound is typically a white to off-white solid and is soluble in polar solvents, which may facilitate its use in various chemical reactions or biological applications. Its structural features suggest potential roles in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or cardiovascular conditions. Additionally, the compound may exhibit interesting properties such as antioxidant or anti-inflammatory activities, although specific biological effects would require further investigation. Overall, 6-Hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid represents a significant compound for research in organic and medicinal chemistry.
Formula:C10H11NO3
InChI:InChI=1/C10H11NO3/c12-7-1-2-8-6(5-7)3-4-11-9(8)10(13)14/h1-2,5,9,11-12H,3-4H2,(H,13,14)
InChI key:WQTOOVAQGWLHKC-UHFFFAOYSA-N
SMILES:c1cc2c(CCNC2C(=O)O)cc1O
Synonyms:
  • 1-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-6-hydroxy-
  • 6-Hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid
Found 3 products.