CAS 91526-17-9
:4-[(Formyloxy)methyl]-5-methyl-1,3-dioxol-2-one
Description:
4-[(Formyloxy)methyl]-5-methyl-1,3-dioxol-2-one, with the CAS number 91526-17-9, is a chemical compound characterized by its unique dioxolane structure, which features a five-membered ring containing two oxygen atoms. This compound is notable for its formyloxy and methyl substituents, which contribute to its reactivity and potential applications in organic synthesis. The presence of the dioxolane moiety suggests that it may exhibit properties typical of cyclic ethers, such as stability under certain conditions and susceptibility to nucleophilic attack. Additionally, the formyloxy group can participate in various chemical reactions, including acylation and alkylation, making this compound a valuable intermediate in the synthesis of more complex molecules. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups. Overall, this compound's structure and substituents indicate potential utility in medicinal chemistry and materials science, although detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C6H6O5
InChI:InChI=1S/C6H6O5/c1-4-5(2-9-3-7)11-6(8)10-4/h3H,2H2,1H3
InChI key:InChIKey=IBKZORCVTJQMQE-UHFFFAOYSA-N
SMILES:C(OC=O)C=1OC(=O)OC1C
Synonyms:- (5-Methyl-2-oxo-1,3-dioxol-4-yl)methyl formate
- (5-Methyl-2-oxo-2H-1,3-dioxol-4-yl)methyl formate
- 1,3-Dioxol-2-one, 4-[(formyloxy)methyl]-5-methyl-
- 4-[(Formyloxy)methyl]-5-methyl-1,3-dioxol-2-one
- Olmesartan Medoxomil Impurity 82
- 4-forMyloxyMethyl-5-Methyl- 1,3-dioxolene-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
4-[(Formyloxy)methyl]-5-methyl-1,3-dioxol-2-one
CAS:Controlled ProductFormula:C6H6O5Color and Shape:NeatMolecular weight:158.109


