CymitQuimica logo

CAS 915283-65-7

:

B-[1-[2-[(2-Methyl-1-oxopropyl)amino]acetyl]-2-pyrrolidinyl]boronic acid

Description:
B-[1-[2-[(2-Methyl-1-oxopropyl)amino]acetyl]-2-pyrrolidinyl]boronic acid, with CAS number 915283-65-7, is a boronic acid derivative that features a complex structure incorporating a pyrrolidine ring and an acylamino group. This compound is characterized by its boron atom, which is typically involved in forming reversible covalent bonds with diols, making it useful in various biochemical applications, particularly in the development of protease inhibitors and in drug design. The presence of the pyrrolidine moiety contributes to its potential biological activity, as it can influence the compound's interaction with biological targets. Additionally, the 2-methyl-1-oxopropyl group may enhance lipophilicity, affecting the compound's solubility and permeability. Overall, this substance is of interest in medicinal chemistry for its potential therapeutic applications, particularly in oncology and other fields where boronic acids have shown promise in modulating biological processes.
Formula:C10H19BN2O4
InChI:InChI=1S/C10H19BN2O4/c1-7(2)10(15)12-6-9(14)13-5-3-4-8(13)11(16)17/h7-8,16-17H,3-6H2,1-2H3,(H,12,15)
InChI key:InChIKey=XGTQGHHNJPRPPY-UHFFFAOYSA-N
SMILES:C(CNC(C(C)C)=O)(=O)N1C(B(O)O)CCC1
Synonyms:
  • Boronic acid, B-[1-[2-[(2-methyl-1-oxopropyl)amino]acetyl]-2-pyrrolidinyl]-
  • B-[1-[2-[(2-Methyl-1-oxopropyl)amino]acetyl]-2-pyrrolidinyl]boronic acid
  • [1-[2-(2-Methylpropanamido)acetyl]pyrrolidin-2-yl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.