CAS 915296-81-0
:2-Chloromethyl-4-(2,4-dichlorophenyl)-6-methylpyridine-3,5-dicarboxylic acid 5-benzyl 3-ethyl ester
Description:
2-Chloromethyl-4-(2,4-dichlorophenyl)-6-methylpyridine-3,5-dicarboxylic acid 5-benzyl 3-ethyl ester is a complex organic compound characterized by its multi-functional structure, which includes a pyridine ring substituted with various functional groups. The presence of chloromethyl and dichlorophenyl groups indicates potential reactivity and biological activity, making it of interest in medicinal chemistry and agrochemical applications. The dicarboxylic acid moiety suggests that it can participate in various chemical reactions, such as esterification or amidation. The ester functional group, specifically the benzyl and ethyl substituents, may influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. This compound is likely to exhibit specific interactions with biological targets, which could be explored for therapeutic purposes. Additionally, its structural complexity may lead to unique physical properties, such as melting point and solubility, which are essential for its application in research and industry. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C24H20Cl3NO4
InChI:InChI=1/C24H20Cl3NO4/c1-3-31-24(30)22-19(12-25)28-14(2)20(21(22)17-10-9-16(26)11-18(17)27)23(29)32-13-15-7-5-4-6-8-15/h4-11H,3,12-13H2,1-2H3
SMILES:CCOC(=O)c1c(CCl)nc(C)c(c1c1ccc(cc1Cl)Cl)C(=O)OCc1ccccc1
Synonyms:- 3,5-Pyridinedicarboxylic Acid, 2-(Chloromethyl)-4-(2,4-Dichlorophenyl)-6-Methyl-, 3-Ethyl 5-(Phenylmethyl) Ester
- 5-Benzyl 3-ethyl 2-(chloromethyl)-4-(2,4-dichlorophenyl)-6-methylpyridine-3,5-dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.