CAS 91532-33-1

1-(3-chloro-4-fluorophenyl)piperazine dihydrochloride

Description:

1-(3-Chloro-4-fluorophenyl)piperazine dihydrochloride, with the CAS number 91532-33-1, is a chemical compound that belongs to the class of piperazine derivatives. It features a piperazine ring, which is a six-membered saturated heterocyclic compound containing two nitrogen atoms. The presence of a 3-chloro-4-fluorophenyl group indicates that the compound has halogen substituents, which can influence its biological activity and solubility. As a dihydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological properties, potentially acting as a ligand for certain receptors in the central nervous system. Its structural characteristics suggest it could be investigated for therapeutic effects, particularly in the context of neuropharmacology. However, specific biological activities, safety profiles, and regulatory status would require further research and validation through scientific studies.

Formula: C₁₀H₁₄Cl₃FN₂

InChI: InChI=1/C10H12ClFN2.2ClH/c11-9-7-8(1-2-10(9)12)14-5-3-13-4-6-14;;/h1-2,7,13H,3-6H2;2*1H

SMILES: c1cc(c(cc1N1CCNCC1)Cl)F.Cl.Cl

Synonyms:

• Piperazine, 1-(3-chloro-4-fluorophenyl)-, hydrochloride (1:2)