CAS 915365-57-0

6-[({1-[2-(azepan-1-yl)ethyl]-1H-1,2,3-triazol-4-yl}methyl)amino]-8-chloro-4-[(3-chloro-4-fluorophenyl)amino]quinoline-3-carbonitrile

Description:

The chemical substance known as 6-[({1-[2-(azepan-1-yl)ethyl]-1H-1,2,3-triazol-4-yl}methyl)amino]-8-chloro-4-[(3-chloro-4-fluorophenyl)amino]quinoline-3-carbonitrile, with the CAS number 915365-57-0, is a complex organic compound characterized by its multi-functional structure. It features a quinoline core, which is a bicyclic aromatic compound known for its biological activity, particularly in medicinal chemistry. The presence of a triazole ring contributes to its potential as a bioactive molecule, often associated with antimicrobial and antifungal properties. The azepane moiety adds to its structural diversity, potentially influencing its pharmacokinetic and pharmacodynamic profiles. Additionally, the presence of chlorine and fluorine substituents suggests enhanced lipophilicity and may improve the compound's binding affinity to biological targets. Overall, this compound's intricate structure indicates potential applications in drug development, particularly in the fields of oncology or infectious diseases, although specific biological activities would require empirical investigation.

Formula: C₂₇H₂₇Cl₂FN₈

InChI: InChI=1/C27H27Cl2FN8/c28-23-12-19(5-6-25(23)30)34-26-18(14-31)15-33-27-22(26)11-20(13-24(27)29)32-16-21-17-38(36-35-21)10-9-37-7-3-1-2-4-8-37/h5-6,11-13,15,17,32H,1-4,7-10,16H2,(H,33,34)

SMILES: C1CCCN(CC1)CCn1cc(CNc2cc3c(c(C#N)cnc3c(c2)Cl)Nc2ccc(c(c2)Cl)F)nn1

Cot inhibitor-1

CAS: 915365-57-0

Cot inhibitor-1

Purity: ≥98%

Molecular weight: 553.46g/mol

Ref: 54-BUP07024

Cot inhibitor-1

CAS: 915365-57-0

Cot inhibitor-1

Molecular weight: 553.46128g/mol

Ref: 54-BISN0292

Cot inhibitor-1

CAS: 915365-57-0

Cot inhibitor-1 selectively blocks Tpl2 kinase, reducing TNF-alpha in blood (IC50: 5.7 nM). It may treat arthritis, IBD, and certain cancers.

Formula: C₂₇H₂₇Cl₂FN₈

Purity: 98.59%

Color and Shape: Solid

Molecular weight: 553.46

Ref: TM-T10865