CymitQuimica logo

CAS 915369-45-8

:

8-chloro-4-hydroxy-6-nitro-quinoline-3-carbonitrile

Description:
8-Chloro-4-hydroxy-6-nitro-quinoline-3-carbonitrile is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a chloro group, a hydroxy group, and a nitro group contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its nitro group can participate in reduction reactions, while the hydroxy group may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. The carbonitrile functional group adds to its versatility, potentially allowing for further chemical modifications. Compounds of this type are often studied for their pharmacological properties, including antimicrobial and anticancer activities, making them of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of chlorine and nitro groups, which can pose health risks.
Formula:C10H4ClN3O3
InChI:InChI=1/C10H4ClN3O3/c11-8-2-6(14(16)17)1-7-9(8)13-4-5(3-12)10(7)15/h1-2,4H,(H,13,15)
Synonyms:
  • 8-Chlor-4-hydroxy-6-nitrochinolin-3-carbonitril
  • 8-chloro-4-hydroxy-6-nitroquinoline-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.