
CAS 915375-35-8
:1,1-Dimethylethyl N-[(1R)-1-(1,2,4-triazolo[4,3-a]pyridin-3-yl)ethyl]carbamate
Description:
1,1-Dimethylethyl N-[(1R)-1-(1,2,4-triazolo[4,3-a]pyridin-3-yl)ethyl]carbamate, with CAS number 915375-35-8, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a triazolopyridine moiety. This compound typically exhibits properties associated with both the carbamate and triazole classes, such as potential biological activity, including antimicrobial or antifungal effects, depending on its specific application. The presence of the dimethyl group contributes to its steric hindrance, which may influence its reactivity and interaction with biological targets. Additionally, the chirality at the (1R) position suggests that the compound may exhibit stereoselective behavior in biological systems. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound is of interest in medicinal chemistry and pharmacology, particularly for its potential therapeutic applications.
Formula:C13H18N4O2
InChI:InChI=1S/C13H18N4O2/c1-9(14-12(18)19-13(2,3)4)11-16-15-10-7-5-6-8-17(10)11/h5-9H,1-4H3,(H,14,18)/t9-/m1/s1
InChI key:InChIKey=YZUAOVCUGSBIPP-SECBINFHSA-N
SMILES:[C@@H](NC(OC(C)(C)C)=O)(C)C=1N2C(=NN1)C=CC=C2
Synonyms:- Carbamic acid, N-[(1R)-1-(1,2,4-triazolo[4,3-a]pyridin-3-yl)ethyl]-, 1,1-dimethylethyl ester
- (R)-tert-Butyl (1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl)carbamate
- 1,1-Dimethylethyl N-[(1R)-1-(1,2,4-triazolo[4,3-a]pyridin-3-yl)ethyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1-Dimethylethyl N-[(1R)-1-(1,2,4-triazolo[4,3-a]pyridin-3-yl)ethyl]carbamate
CAS:Formula:C13H18N4O2Molecular weight:262.3076
