CAS 91538-79-3
:4,4'-bis(4-ethylcyclohexyl)biphenyl
Description:
4,4'-bis(4-ethylcyclohexyl)biphenyl, with the CAS number 91538-79-3, is an organic compound characterized by its biphenyl structure, where two phenyl rings are connected by a single bond. This compound features two 4-ethylcyclohexyl substituents at the para positions of the biphenyl, which contributes to its unique physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. The presence of the ethylcyclohexyl groups enhances its thermal stability and solubility in various organic solvents, making it useful in applications such as heat transfer fluids and as a component in certain polymer formulations. Additionally, it exhibits low volatility and good chemical resistance, which are desirable traits in industrial applications. Safety data should be reviewed for handling and exposure guidelines, as with any chemical substance. Overall, 4,4'-bis(4-ethylcyclohexyl)biphenyl is valued for its stability and performance in specialized chemical applications.
Formula:C28H38
InChI:InChI=1/C28H38/c1-3-21-5-9-23(10-6-21)25-13-17-27(18-14-25)28-19-15-26(16-20-28)24-11-7-22(4-2)8-12-24/h13-24H,3-12H2,1-2H3
SMILES:CCC1CCC(CC1)c1ccc(cc1)c1ccc(cc1)C1CCC(CC)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.