CAS 91539-82-1
:1-(4-chloroquinazolin-2-yl)-N,N-dimethylmethanamine
Description:
1-(4-chloroquinazolin-2-yl)-N,N-dimethylmethanamine, with the CAS number 91539-82-1, is a chemical compound that features a quinazoline moiety substituted with a chloro group and a dimethylamino group. This compound is characterized by its heterocyclic structure, which includes a fused benzene and pyrimidine ring system, contributing to its potential biological activity. The presence of the chloro substituent can influence the compound's reactivity and solubility, while the dimethylamino group may enhance its basicity and lipophilicity. Such characteristics often make this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, its unique structure may impart specific pharmacological properties, making it a candidate for further research in drug discovery and development. As with many chemical substances, safety and handling precautions should be observed, given the potential for toxicity associated with certain functional groups.
Formula:C11H12ClN3
InChI:InChI=1/C11H12ClN3/c1-15(2)7-10-13-9-6-4-3-5-8(9)11(12)14-10/h3-6H,7H2,1-2H3
SMILES:CN(C)Cc1nc2ccccc2c(Cl)n1
Synonyms:- 2-quinazolinemethanamine, 4-chloro-N,N-dimethyl-
- N-[(4-chloroquinazolin-2-yl)methyl]-N,N-dimethylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(4-Chloro-quinazolin-2-ylmethyl)-dimethyl-amine
CAS:Formula:C10H10ClN3Purity:97%Color and Shape:SolidMolecular weight:207.65954-Chloro-N,N-dimethylquinazolin-2-amine
CAS:4-Chloro-N,N-dimethylquinazolin-2-aminePurity:97%Molecular weight:207.66g/mol4-Chloro-N,N-dimethylquinazolin-2-amine
CAS:<p>4-Chloro-N,N-dimethylquinazolin-2-amine is a silicone that is used as an active substance in polydimethylsiloxane. It has a cyclic structure and transesterification reaction with alkanoic acid. This active substance has hydrophobic properties that make it suitable for use in deodorizing and encapsulated products. 4-Chloro-N,N-dimethylquinazolin-2-amine also has the ability to react with alcohols to form esters, which can be used as solvents or fragrances.</p>Formula:C11H12ClN3Purity:Min. 95%Molecular weight:221.68 g/mol



