CAS 915402-00-5
:B-[3-[(2,2,2-Trifluoroethyl)thio]phenyl]boronic acid
Description:
B-[3-[(2,2,2-Trifluoroethyl)thio]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a thioether group, specifically a trifluoroethyl thio group, which enhances its lipophilicity and may influence its reactivity and biological activity. The trifluoroethyl moiety contributes to the compound's unique electronic properties and stability. Boronic acids are often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the presence of the boronic acid group allows for potential applications in drug development, particularly in targeting specific biological pathways. Overall, this compound exemplifies the versatility of boronic acids in both synthetic and pharmaceutical chemistry, with its unique structural features contributing to its functional properties.
Formula:C8H8BF3O2S
InChI:InChI=1S/C8H8BF3O2S/c10-8(11,12)5-15-7-3-1-2-6(4-7)9(13)14/h1-4,13-14H,5H2
InChI key:InChIKey=ORNQEDKTMCJEHC-UHFFFAOYSA-N
SMILES:S(CC(F)(F)F)C1=CC(B(O)O)=CC=C1
Synonyms:- Boronic acid, B-[3-[(2,2,2-trifluoroethyl)thio]phenyl]-
- B-[3-[(2,2,2-Trifluoroethyl)thio]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
