CymitQuimica logo

CAS 915402-02-7

:

B-[3-[(2,2-Difluoroethyl)thio]phenyl]boronic acid

Description:
B-[3-[(2,2-Difluoroethyl)thio]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications such as organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a thioether group, specifically a 2,2-difluoroethyl thio group, which enhances its chemical reactivity and solubility properties. The difluoroethyl moiety contributes to the compound's unique electronic characteristics, potentially influencing its interactions in biological systems. Boronic acids are also recognized for their role in the development of targeted therapies and drug delivery systems, particularly in the context of cancer treatment. Additionally, the presence of fluorine atoms can impart desirable properties such as increased metabolic stability and altered lipophilicity. Overall, this compound exemplifies the versatility of boronic acids in synthetic and pharmaceutical chemistry, with potential applications in various fields.
Formula:C8H9BF2O2S
InChI:InChI=1S/C8H9BF2O2S/c10-8(11)5-14-7-3-1-2-6(4-7)9(12)13/h1-4,8,12-13H,5H2
InChI key:InChIKey=PRMUZXGMCOKPHU-UHFFFAOYSA-N
SMILES:S(CC(F)F)C1=CC(B(O)O)=CC=C1
Synonyms:
  • B-[3-[(2,2-Difluoroethyl)thio]phenyl]boronic acid
  • Boronic acid, B-[3-[(2,2-difluoroethyl)thio]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.