
CAS 915402-11-8
:2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-5-carbonitrile
Description:
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-5-carbonitrile is a chemical compound characterized by its complex structure, which includes a benzo[b]thiophene moiety and a dioxaborolane group. The presence of the dioxaborolane unit suggests that this compound may exhibit properties related to boron chemistry, such as potential applications in organic synthesis or materials science. The carbonitrile functional group indicates that it may possess notable electronic properties, potentially making it useful in electronic applications or as a building block in organic synthesis. The tetramethyl substitution on the dioxaborolane enhances its steric bulk, which can influence its reactivity and solubility. Overall, this compound's unique structural features may contribute to its utility in various chemical applications, including as a ligand in coordination chemistry or as an intermediate in the synthesis of more complex organic molecules. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H16BNO2S
InChI:InChI=1S/C15H16BNO2S/c1-14(2)15(3,4)19-16(18-14)13-8-11-7-10(9-17)5-6-12(11)20-13/h5-8H,1-4H3
InChI key:InChIKey=PEENVPPNRCEMSM-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=3C(S2)=CC=C(C#N)C3
Synonyms:- Benzo[b]thiophene-5-carbonitrile, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-5-carbonitrile
CAS:Formula:C15H16BNO2SMolecular weight:285.1690
