CAS 915402-18-5

3-Thiophenamine, tetrahydro-N-2-propyn-1-yl-, 1,1-dioxide, hydrochloride (1:1)

Description:

3-Thiophenamine, tetrahydro-N-2-propyn-1-yl-, 1,1-dioxide, hydrochloride (1:1), identified by CAS number 915402-18-5, is a chemical compound characterized by its unique structure that includes a thiophene ring and a tetrahydro group. This compound features a nitrogen atom that is part of an amine functional group, which is further substituted with a propynyl group. The presence of the 1,1-dioxide indicates that the compound has two oxygen atoms double-bonded to the sulfur atom in the thiophene ring, enhancing its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further empirical studies. Its synthesis and characterization would involve standard organic chemistry techniques, and safety data should be consulted for handling and usage in laboratory settings.

Formula: C₇H₁₁NO₂S·ClH

InChI: InChI=1S/C7H11NO2S.ClH/c1-2-4-8-7-3-5-11(9,10)6-7;/h1,7-8H,3-6H2;1H

InChI key: InChIKey=JMSFIQZLOUSPKH-UHFFFAOYSA-N

SMILES: N(CC#C)C1CS(=O)(=O)CC1.Cl

Synonyms:

• 3-Thiophenamine, tetrahydro-N-2-propyn-1-yl-, 1,1-dioxide, hydrochloride (1:1)