CymitQuimica logo

CAS 915402-27-6

:

1,3-Dihydro-4-(3-pyridinyl)-2H-imidazol-2-one

Description:
1,3-Dihydro-4-(3-pyridinyl)-2H-imidazol-2-one, with the CAS number 915402-27-6, is a heterocyclic organic compound characterized by its imidazole ring structure, which is fused with a pyridine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for imidazole derivatives. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the pyridine ring can influence its electronic properties and reactivity, potentially enhancing its interaction with biological targets. Additionally, the imidazole ring is known for its ability to participate in hydrogen bonding and coordination with metal ions, which can be relevant in various chemical and biological contexts. Overall, this compound's unique structural features contribute to its potential applications in drug discovery and development, as well as in other fields such as agrochemicals and materials science.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c12-8-10-5-7(11-8)6-2-1-3-9-4-6/h1-5H,(H2,10,11,12)
InChI key:InChIKey=RJBGXPFSHQEGSC-UHFFFAOYSA-N
SMILES:O=C1NC(=CN1)C=2C=CC=NC2
Synonyms:
  • 1,3-Dihydro-4-(3-pyridinyl)-2H-imidazol-2-one
  • 2H-Imidazol-2-one, 1,3-dihydro-4-(3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.