CAS 915402-38-9

4-(1,3-Dioxolan-2-ylmethoxy)-N-hydroxybenzenecarboximidamide

Description:

4-(1,3-Dioxolan-2-ylmethoxy)-N-hydroxybenzenecarboximidamide, with the CAS number 915402-38-9, is a chemical compound characterized by its unique structural features, including a dioxolane ring and a hydroxylamine functional group. This compound typically exhibits properties associated with both its aromatic and heterocyclic components, which may influence its solubility, reactivity, and potential biological activity. The presence of the hydroxylamine group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or redox reactions. Additionally, the dioxolane moiety can contribute to the compound's stability and may affect its interaction with biological targets. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature often exhibit moderate to high polarity, which can influence their behavior in biological systems. Overall, this compound may have potential applications in medicinal chemistry or as a biochemical probe, although further studies would be necessary to elucidate its specific properties and potential uses.

Formula: C₁₁H₁₄N₂O₄

InChI: InChI=1S/C11H14N2O4/c12-11(13-14)8-1-3-9(4-2-8)17-7-10-15-5-6-16-10/h1-4,10,14H,5-7H2,(H2,12,13)

InChI key: InChIKey=YHRAQPOXCKNDSN-UHFFFAOYSA-N

SMILES: O(CC1OCCO1)C2=CC=C(C(NO)=N)C=C2

Synonyms:

• 4-(1,3-Dioxolan-2-ylmethoxy)-N-hydroxybenzenecarboximidamide
• Benzenecarboximidamide, 4-(1,3-dioxolan-2-ylmethoxy)-N-hydroxy-