CymitQuimica logo

CAS 91541-81-0

:

sodium 4-(4-{[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propyl]sulfanyl}phenyl)-4-hydroxy-3-methylbutanoate

Description:
Sodium 4-(4-{[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propyl]sulfanyl}phenyl)-4-hydroxy-3-methylbutanoate, with CAS number 91541-81-0, is a complex organic compound characterized by its unique structural features, including multiple functional groups such as hydroxyl, acetyl, and sulfanyl moieties. This compound is likely to exhibit amphiphilic properties due to the presence of both hydrophilic (sodium salt and hydroxyl groups) and hydrophobic (aromatic and aliphatic hydrocarbon chains) components, which may influence its solubility in various solvents. The presence of the sodium ion suggests that it is a salt, which typically enhances its solubility in water compared to its neutral counterparts. Additionally, the compound may possess biological activity due to its structural similarity to other bioactive molecules, potentially making it of interest in pharmaceutical or biochemical applications. Its complex structure may also lead to interesting interactions in biological systems, warranting further investigation into its properties and potential uses.
Formula:C25H31NaO6S
InChI:InChI=1/C25H32O6S.Na/c1-4-6-21-22(12-11-20(17(3)26)25(21)30)31-13-5-14-32-19-9-7-18(8-10-19)24(29)16(2)15-23(27)28;/h7-12,16,24,29-30H,4-6,13-15H2,1-3H3,(H,27,28);/q;+1/p-1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.