CAS 91544-05-7

1-(3,6-Dimethyl-4-pyridazinyl)ethanone

Description:

1-(3,6-Dimethyl-4-pyridazinyl)ethanone, identified by its CAS number 91544-05-7, is a chemical compound that features a pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound is characterized by the presence of two methyl groups at the 3 and 6 positions of the pyridazine ring, contributing to its unique structural and electronic properties. The ethanone functional group indicates the presence of a carbonyl group (C=O) adjacent to an ethyl group, which can influence the compound's reactivity and interactions with other molecules. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the pyridazine moiety can also impart specific pharmacological properties, potentially affecting its solubility, stability, and binding affinity to biological targets. Overall, 1-(3,6-Dimethyl-4-pyridazinyl)ethanone represents a class of compounds that may have diverse applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₈H₁₀N₂O

InChI: InChI=1S/C8H10N2O/c1-5-4-8(7(3)11)6(2)10-9-5/h4H,1-3H3

InChI key: InChIKey=GOPHTLUTFFNJLI-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(C)N=NC(C)=C1

Synonyms:

• 1-(3,6-Dimethylpyridazin-4-yl)ethan-1-one
• 1-(3,6-Dimethyl-4-pyridazinyl)ethanone
• 4-Acetyl-3,6-dimethylpyridazine
• Ethanone, 1-(3,6-dimethyl-4-pyridazinyl)-