CAS 91547-59-0

1,4-anhydro-2-deoxy-D-erythro-pentitol

Description:

1,4-Anhydro-2-deoxy-D-erythro-pentitol, with the CAS number 91547-59-0, is a carbohydrate derivative characterized by its unique structural features. It is a five-carbon sugar alcohol that lacks a hydroxyl group at the second carbon position, which classifies it as a deoxy sugar. The anhydro form indicates that it has undergone dehydration, resulting in a cyclic structure that is typically stable under physiological conditions. This compound is known for its role in various biochemical processes and can be involved in the synthesis of nucleotides and other biologically relevant molecules. Its stereochemistry, particularly the erythro configuration, contributes to its specific interactions in biological systems. Additionally, 1,4-anhydro-2-deoxy-D-erythro-pentitol may exhibit solubility in water and other polar solvents, making it relevant for various applications in biochemistry and medicinal chemistry. Understanding its properties and reactivity is crucial for exploring its potential uses in research and industry.

Formula: C₅H₁₀O₃

InChI: InChI=1/C5H10O3/c6-3-5-4(7)1-2-8-5/h4-7H,1-3H2/t4-,5+/m0/s1

Synonyms:

• 1,2-Dideoxy-beta-D-ribofuranose
• 1,4-Anhydro-2-deoxy-D-ribitol
• D-erythro-Pentitol, 1,4-anhydro-2-deoxy-, (Z,E,E,E,E)-

1,2-Dideoxy-D-ribofuranose

CAS: 91547-59-0

Formula: C₅H₁₀O₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 118.1311

Ref: IN-DA00696I

1,2-Dideoxy-D-ribofuranose

CAS: 91547-59-0

1,2-Dideoxy-D-ribofuranose

Purity: 95%

Molecular weight: 118.13g/mol

Ref: 54-OR1035979

1,2-Dideoxy-D-ribofuranose

CAS: 91547-59-0

Ref: 7W-GC2422

1,2-Dideoxy-D-ribofuranose

CAS: 91547-59-0

Precursor for the preparation of abasic nucleoside analogues

Formula: C₅H₁₀O₃

Purity: Min. 98 Area-%

Color and Shape: Clear Liquid

Molecular weight: 118.13 g/mol

Ref: 3D-MD06425

1,2-Dideoxy-D-ribofuranose

CAS: 91547-59-0

Purity: 95%

Molecular weight: 118.1320038

Ref: 10-F615789