CAS 91553-70-7
:3-(2,4-dimethylphenoxy)-N-methylpropan-1-amine
Description:
3-(2,4-Dimethylphenoxy)-N-methylpropan-1-amine, with the CAS number 91553-70-7, is an organic compound characterized by its amine functional group and a phenoxy moiety. This compound features a propan-1-amine backbone, which is substituted with a methyl group on the nitrogen atom, enhancing its basicity and potential for forming hydrogen bonds. The presence of the 2,4-dimethylphenoxy group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit biological activity, potentially acting as intermediates in the synthesis of pharmaceuticals or agrochemicals. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of multiple methyl groups can affect the steric hindrance and electronic properties of the molecule, which may be relevant in its reactivity and interaction with other substances. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.
Formula:C12H19NO
InChI:InChI=1/C12H19NO/c1-10-5-6-12(11(2)9-10)14-8-4-7-13-3/h5-6,9,13H,4,7-8H2,1-3H3
SMILES:Cc1ccc(c(C)c1)OCCCNC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.