CAS 91556-75-1
:2-(3-Pyridinyl)-1-azabicyclo[2.2.2]octane
Description:
2-(3-Pyridinyl)-1-azabicyclo[2.2.2]octane, with the CAS number 91556-75-1, is a bicyclic compound featuring a nitrogen atom in its structure, which classifies it as a bicyclic amine. This compound is characterized by its unique bicyclic framework, which consists of a saturated bicyclic system and a pyridine ring. The presence of the pyridine moiety contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. The azabicyclo structure enhances its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, this compound may exhibit specific solubility and stability characteristics influenced by its molecular structure. Its potential applications could span across various fields, including drug development and synthesis of novel compounds. However, detailed studies on its specific properties, such as melting point, boiling point, and reactivity, would be necessary to fully understand its behavior in different chemical environments.
Formula:C12H16N2
InChI:InChI=1S/C12H16N2/c1-2-11(9-13-5-1)12-8-10-3-6-14(12)7-4-10/h1-2,5,9-10,12H,3-4,6-8H2
InChI key:InChIKey=YJYPZLAZNIGNRP-UHFFFAOYSA-N
SMILES:C1(N2CCC(C1)CC2)C=3C=CC=NC3
Synonyms:- RJR 2429
- 1-Azabicyclo[2.2.2]octane, 2-(3-pyridinyl)-
- Quinuclidine, 2-(3-pyridyl)-
- 2-(3-Pyridinyl)-1-azabicyclo[2.2.2]octane
- TC 2429
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
RJR-2429
CAS:RJR-2429 is a potent AChR agonist.Formula:C12H16N2Color and Shape:SolidMolecular weight:188.27
