CAS 91557-27-6

N-(2-methoxy-5-methylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine

Description:

N-(2-methoxy-5-methylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine, with the CAS number 91557-27-6, is a chemical compound characterized by its thiazine ring structure, which incorporates both sulfur and nitrogen atoms. This compound features a methoxy group and a methyl-substituted phenyl group, contributing to its potential biological activity and solubility properties. The thiazine moiety is known for its role in various pharmacological applications, often exhibiting properties such as antimicrobial or anti-inflammatory effects. The presence of the amine functional group suggests potential for hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the compound's molecular structure may allow for various synthetic modifications, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this compound represents a unique structure that may have implications in drug development and therapeutic applications.

Formula: C₁₂H₁₆N₂OS

InChI: InChI=1/C12H16N2OS/c1-9-4-5-11(15-2)10(8-9)14-12-13-6-3-7-16-12/h4-5,8H,3,6-7H2,1-2H3,(H,13,14)

SMILES: Cc1ccc(c(c1)NC1=NCCCS1)OC

Synonyms:

• (5,6-Dihydro-4H-[1,3]thiazin-2-yl)-(2-methoxy-5-methyl-phenyl)-amine
• 4H-1,3-thiazin-2-amine, 5,6-dihydro-N-(2-methoxy-5-methylphenyl)-
• N-(2-Methoxy-5-methylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine

N-(2-Methoxy-5-methylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine

CAS: 91557-27-6

Versatile small molecule scaffold

Formula: C₁₂H₁₆N₂OS

Purity: Min. 95%

Molecular weight: 236.34 g/mol

Ref: 3D-RDA55727