CymitQuimica logo

CAS 91560-28-0

:

4-[(2-Amino-6-methyl-4-pyrimidinyl)amino]benzoic acid

Description:
4-[(2-Amino-6-methyl-4-pyrimidinyl)amino]benzoic acid, with the CAS number 91560-28-0, is a chemical compound characterized by its structure, which includes a benzoic acid moiety substituted with an amino group and a pyrimidine derivative. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of both amino and carboxylic acid functional groups. It may display biological activity, particularly in the context of pharmaceutical applications, as compounds with similar structures are often investigated for their roles as enzyme inhibitors or in other therapeutic contexts. The presence of the pyrimidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its molecular weight and specific reactivity can influence its behavior in various chemical reactions and biological systems. Overall, this compound represents a class of molecules that bridge organic chemistry and biochemistry, with implications for drug design and development.
Formula:C12H12N4O2
InChI:InChI=1S/C12H12N4O2/c1-7-6-10(16-12(13)14-7)15-9-4-2-8(3-5-9)11(17)18/h2-6H,1H3,(H,17,18)(H3,13,14,15,16)
InChI key:InChIKey=ACABARVIRZLTTK-UHFFFAOYSA-N
SMILES:N(C=1C=C(C)N=C(N)N1)C2=CC=C(C(O)=O)C=C2
Synonyms:
  • Benzoic acid, 4-[(2-amino-6-methyl-4-pyrimidinyl)amino]-
  • Benzoic acid, p-[(2-amino-6-methyl-4-pyrimidinyl)amino]-
  • 2-Amino-4-(p-carboxyanilino)-6-methylpyrimidine
  • 4-[(2-Amino-6-methyl-4-pyrimidinyl)amino]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.