CAS 91560-85-9

1-(3-bromobenzyl)-4-methylpiperazine

Description:

1-(3-Bromobenzyl)-4-methylpiperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a bromobenzyl group at the first position and a methyl group at the fourth position of the piperazine ring contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the piperazine moiety, which can engage in hydrogen bonding. It may also display biological activity, making it of interest in medicinal chemistry and pharmacology. The bromine atom introduces a halogen, which can influence the compound's reactivity and interaction with biological targets. Additionally, the structure suggests potential for various substitution reactions, allowing for further derivatization. Safety and handling precautions should be observed due to the presence of the bromine atom, which can pose health risks. Overall, 1-(3-bromobenzyl)-4-methylpiperazine is a compound of interest for research in both synthetic and medicinal chemistry contexts.

Formula: C₁₂H₁₇BrN₂

InChI: InChI=1/C12H17BrN2/c1-14-5-7-15(8-6-14)10-11-3-2-4-12(13)9-11/h2-4,9H,5-8,10H2,1H3

Synonyms:

• 1-(3-Bromo-benzyl)-4-methyl-piperazine

1-[(2-Bromophenyl)methyl]-4-methylpiperazine

Controlled Product

CAS: 91560-85-9

Versatile small molecule scaffold

Formula: C₁₂H₁₇BrN₂

Purity: Min. 95%

Molecular weight: 269.18 g/mol

Ref: 3D-RDA56085