
CAS 91563-36-9
:2-Methyl-3-(phenylmethyl)-3-pyrrolidinol
Description:
2-Methyl-3-(phenylmethyl)-3-pyrrolidinol, with the CAS number 91563-36-9, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a methyl group and a phenylmethyl (benzyl) substituent, contributing to its unique properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents, reflecting its hydrophobic characteristics due to the presence of the aromatic phenyl group. The presence of the hydroxyl group (-OH) in the pyrrolidine ring suggests that it may exhibit hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could potentially lead to biological activity. However, specific data regarding its toxicity, stability, and applications may require further investigation in scientific literature. Overall, 2-Methyl-3-(phenylmethyl)-3-pyrrolidinol represents a complex organic molecule with potential implications in various chemical and pharmaceutical contexts.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c1-10-12(14,7-8-13-10)9-11-5-3-2-4-6-11/h2-6,10,13-14H,7-9H2,1H3
InChI key:InChIKey=IBNNNGXPQMMBKW-UHFFFAOYSA-N
SMILES:C(C1(O)C(C)NCC1)C2=CC=CC=C2
Synonyms:- 3-Benzyl-2-methyl-pyrrolidin-3-ol
- 3-Pyrrolidinol, 2-methyl-3-(phenylmethyl)-
- 3-Benzyl-2-methylpyrrolidin-3-ol
- 3-Pyrrolidinol, 3-benzyl-2-methyl-
- 2-Methyl-3-(phenylmethyl)-3-pyrrolidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.