CAS 915707-40-3

4-(1-Methyl-1H-pyrazol-3-yl)benzenemethanamine

Description:

4-(1-Methyl-1H-pyrazol-3-yl)benzenemethanamine, with the CAS number 915707-40-3, is an organic compound characterized by its unique structure, which includes a pyrazole ring and a benzene ring connected by a methanamine group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of amine functional groups. It may display moderate solubility in polar solvents, influenced by the presence of the amine group, which can engage in hydrogen bonding. The pyrazole moiety can contribute to biological activity, making this compound of interest in medicinal chemistry and drug development. Additionally, its molecular structure suggests potential applications in various fields, including agrochemicals and materials science. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity. Overall, this compound represents a versatile structure with implications in both research and practical applications.

Formula: C₁₁H₁₃N₃

InChI: InChI=1S/C11H13N3/c1-14-7-6-11(13-14)10-4-2-9(8-12)3-5-10/h2-7H,8,12H2,1H3

InChI key: InChIKey=ABWRSDPFKICMIH-UHFFFAOYSA-N

SMILES: CN1N=C(C=C1)C2=CC=C(CN)C=C2

Synonyms:

• Benzenemethanamine, 4-(1-methyl-1H-pyrazol-3-yl)-
• (4-(1-Methyl-1H-pyrazol-3-yl)phenyl)methanamine
• 4-(1-Methyl-1H-pyrazol-3-yl)benzenemethanamine
• 1-[4-(1-Methyl-1H-pyrazol-3-yl)phenyl]methanamine

[4-(1-Methyl-1H-pyrazol-3-yl)phenyl]methylamine

CAS: 915707-40-3

[4-(1-Methyl-1H-pyrazol-3-yl)phenyl]methylamine

Purity: 97%

Color and Shape: Brown Low-Melting Solid

Molecular weight: 187.24g/mol

Ref: 54-OR12284

(4-(1-Methyl-1H-pyrazol-3-yl)phenyl)methanamine

CAS: 915707-40-3

Purity: 98%

Molecular weight: 187.2460022

Ref: 10-F777765