CAS 915707-71-0

1-(9H-Fluoren-9-ylmethyl) 4-(2-propen-1-yl) (2S)-1,2,4-piperazinetricarboxylate

Description:

1-(9H-Fluoren-9-ylmethyl) 4-(2-propen-1-yl) (2S)-1,2,4-piperazinetricarboxylate, with CAS number 915707-71-0, is a chemical compound characterized by its complex structure, which includes a piperazine ring and multiple carboxylate functional groups. This compound features a fluorenylmethyl group, which contributes to its aromatic properties and potential for interactions in biological systems. The presence of the propenyl group suggests potential reactivity, particularly in polymerization or addition reactions. The stereochemistry indicated by the (2S) designation implies specific spatial arrangements that can influence the compound's biological activity and interactions with receptors or enzymes. Its tricarboxylate nature suggests it may participate in various chemical reactions, including esterification or coordination with metal ions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a building block in organic synthesis, owing to its unique structural features and functional groups.

Formula: C₂₄H₂₄N₂O₆

InChI: InChI=1S/C24H24N2O6/c1-2-13-31-23(29)25-11-12-26(21(14-25)22(27)28)24(30)32-15-20-18-9-5-3-7-16(18)17-8-4-6-10-19(17)20/h2-10,20-21H,1,11-15H2,(H,27,28)/t21-/m0/s1

InChI key: InChIKey=HQKQHTTWUFGNQG-NRFANRHFSA-N

SMILES: C(OC(=O)N1[C@H](C(O)=O)CN(C(OCC=C)=O)CC1)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 1-(9H-Fluoren-9-ylmethyl) 4-(2-propen-1-yl) (2S)-1,2,4-piperazinetricarboxylate
• 1,2,4-Piperazinetricarboxylic acid, 1-(9H-fluoren-9-ylmethyl) 4-(2-propen-1-yl) ester, (2S)-