CAS 915731-88-3

[4-(2,4-Dichlorophenyl)-6-dimethylcarbamoylmethyl-2-methyl-5-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-3-ylmethyl]carbamic acid tert-butyl ester

Description:

The chemical substance with the name "[4-(2,4-Dichlorophenyl)-6-dimethylcarbamoylmethyl-2-methyl-5-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-3-ylmethyl]carbamic acid tert-butyl ester" and CAS number "915731-88-3" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as carbamates and pyrrolopyridines. This compound features a dichlorophenyl moiety, contributing to its potential biological activity, and a tert-butyl ester group that may influence its solubility and stability. The presence of dimethylcarbamoyl and oxo groups suggests potential reactivity and interactions with biological targets. Such compounds are often investigated for their pharmacological properties, including anti-inflammatory or anticancer activities. The specific arrangement of atoms and functional groups in this molecule can lead to unique chemical behavior, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully understand its properties, including its solubility, stability, and biological effects.

Formula: C₂₄H₂₈Cl₂N₄O₄

InChI: InChI=1/C24H28Cl2N4O4/c1-13-16(10-27-23(33)34-24(2,3)4)20(15-8-7-14(25)9-17(15)26)21-18(28-13)11-30(22(21)32)12-19(31)29(5)6/h7-9H,10-12H2,1-6H3,(H,27,33)

SMILES: Cc1c(CN=C(O)OC(C)(C)C)c(c2ccc(cc2Cl)Cl)c2c(CN(CC(=O)N(C)C)C2=O)n1