CAS 91575-25-6
:arg-gly-asp-ser-pro-ala-ser-ser-lys-pro
Description:
The chemical substance known as "arg-gly-asp-ser-pro-ala-ser-ser-lys-pro," with the CAS number 91575-25-6, is a synthetic peptide composed of a specific sequence of amino acids. This peptide includes arginine (Arg), glycine (Gly), aspartic acid (Asp), serine (Ser), proline (Pro), alanine (Ala), and lysine (Lys), which are linked together in a defined order. Peptides like this one are often studied for their biological activity, particularly in the context of cell adhesion, signaling, and interaction with various receptors. The presence of specific amino acids can influence the peptide's conformation, stability, and interaction with other biomolecules. Additionally, this peptide may have applications in biomedical research, drug development, and therapeutic interventions, particularly in areas related to tissue engineering and regenerative medicine. Its properties, such as solubility, stability, and biological activity, can vary based on the sequence and modifications, making it a subject of interest in peptide chemistry and molecular biology.
Formula:C40H68N14O16
InChI:InChI=1/C40H68N14O16/c1-20(31(61)50-24(17-55)35(65)51-25(18-56)34(64)49-22(8-2-3-11-41)37(67)54-14-6-10-28(54)39(69)70)47-36(66)27-9-5-13-53(27)38(68)26(19-57)52-33(63)23(15-30(59)60)48-29(58)16-46-32(62)21(42)7-4-12-45-40(43)44/h20-28,55-57H,2-19,41-42H2,1H3,(H,46,62)(H,47,66)(H,48,58)(H,49,64)(H,50,61)(H,51,65)(H,52,63)(H,59,60)(H,69,70)(H4,43,44,45)
SMILES:CC(C(=NC(CO)C(=NC(CO)C(=NC(CCCCN)C(=O)N1CCCC1C(=O)O)O)O)O)N=C(C1CCCN1C(=O)C(CO)N=C(C(CC(=O)O)N=C(CN=C(C(CCCNC(=N)N)N)O)O)O)O
Synonyms:- H-Arg-Gly-Asp-Ser-Pro-Ala-Ser-Ser-Lys-Pro-OH
- N~5~-(diaminomethylidene)ornithylglycyl-alpha-aspartylserylprolylalanylserylseryllysylproline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Arg-Gly-Asp-Ser-Pro-Ala-Ser-Ser-Lys-Pro-OH
CAS:H-Arg-Gly-Asp-Ser-Pro-Ala-Ser-Ser-Lys-Pro-OH is a peptide that is derived from the sequence of fibronectin. It has been shown to be taken up by urchin cells, which are spherical and have a toroidal shape. This peptide also has modular properties and forms a particle with a pegylated molecule. The amino acid sequence of this peptide is unmodified. H-Arg-Gly-Asp-Ser-Pro-Ala-Ser-Ser-Lys Pro -OH is a synthetic ligand that can be used in the ligation of mesenchyme cells.Formula:C40H68N14O16Purity:Min. 95%Molecular weight:1,001.05 g/molH-Arg-Gly-Asp-Ser-Pro-Ala-Ser-Ser-Lys-Pro-OH
CAS:<p>The RGD peptide RGDSPASSKP inhibits fibronectin adhesion to fibroblasts.</p>Formula:C40H68N14O16Purity:97.6%Molecular weight:1001.07

