CAS 915769-50-5
:Dovitinib lactate
Description:
Dovitinib lactate, with the CAS number 915769-50-5, is a chemical compound that serves as a lactate salt of dovitinib, a potent inhibitor of multiple receptor tyrosine kinases, including VEGFR, PDGFR, and FGFR. This compound is primarily investigated for its potential therapeutic applications in oncology, particularly in the treatment of various cancers by inhibiting tumor growth and angiogenesis. Dovitinib lactate is characterized by its ability to interfere with signaling pathways that promote cancer cell proliferation and survival. The lactate form enhances its solubility and bioavailability, making it more suitable for pharmaceutical formulations. In terms of physical properties, it typically appears as a white to off-white solid, and its stability and solubility can vary depending on the formulation and environmental conditions. As with many pharmaceutical compounds, safety and efficacy are evaluated through clinical trials, and its use is subject to regulatory approval. Overall, dovitinib lactate represents a significant area of research in targeted cancer therapies.
Formula:C21H21FN6O·C3H6O3·H2O
InChI:InChI=1/C21H21FN6O.C3H6O3.H2O/c1-27-7-9-28(10-8-27)12-5-6-14-16(11-12)25-20(24-14)18-19(23)17-13(22)3-2-4-15(17)26-21(18)29;1-2(4)3(5)6;/h2-6,11H,7-10H2,1H3,(H,24,25)(H3,23,26,29);2,4H,1H3,(H,5,6);1H2
SMILES:CN1CCN(CC1)c1ccc2c(c1)[nH]c(c1c(c3c(cccc3nc1O)F)N)n2.CC(C(=O)O)O.O
Synonyms:- 4-Amino-5-fluoro-3-[6-(4-methyl-1-piperazinyl)-1H-benzimidazol-2-yl]-2(1H)-quinolinone 2-hydroxypropanoate hydrate (1:1:1)
- 4-amino-5-fluoro-3-[5-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]quinolin-2(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Amino-5-fluoro-3-(6-(4-methylpiperazin-1-yl)-1H-benzo[d]imidazol-2-yl)quinolin-2(1H)-one 2-hydroxypropanoate hydrate
CAS:Formula:C24H29FN6O5Purity:98%Molecular weight:500.5227Dovitinib lactate hydrate
CAS:Dovitinib lactate hydrate (TKI258) is the Lactate of Dovitinib, which is a multitargeted RTK inhibitor, mostly for class III (FLT3/c-Kit).Formula:C24H27FN6O4Purity:99.82%Color and Shape:SolidMolecular weight:482.51Dovitinib Lactate
CAS:<p>Receptor tyrosine kinase inhibitor; anti-angiogenesis; anti-oncogenesis</p>Formula:C21H21FN6O·C3H6O3·H2OPurity:Min. 95%Color and Shape:Light (Or Pale) Yellow To Brown SolidMolecular weight:500.52 g/mol



