CAS 915873-63-1

4-(7-chloro-2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine

Description:

4-(7-chloro-2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine is a chemical compound characterized by its unique structural features, which include a thiazole ring and a benzodioxin moiety. The presence of a chlorine atom at the 7-position of the benzodioxin structure contributes to its potential biological activity. This compound may exhibit properties such as antimicrobial or anticancer activity, which is common among thiazole derivatives. The thiazole ring is known for its role in various pharmacological applications, often serving as a scaffold for drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present in its structure. Its CAS number, 915873-63-1, allows for easy identification and retrieval of information regarding its synthesis, properties, and potential applications in research and industry. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and drug discovery.

Formula: C₁₁H₉ClN₂O₂S

InChI: InChI=1/C11H9ClN2O2S/c12-7-4-10-9(15-1-2-16-10)3-6(7)8-5-17-11(13)14-8/h3-5H,1-2H2,(H2,13,14)

SMILES: C1COc2cc(c(cc2O1)c1csc(=N)[nH]1)Cl

4-(7-chloro-2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-amine

CAS: 915873-63-1

Purity: 95.0%

Molecular weight: 268.7200012207031

Ref: 10-F315647