CAS 915882-06-3

N-(6-methyl-2-propyl-pyrimidin-4-yl)propane-1,3-diamine

Description:

N-(6-methyl-2-propyl-pyrimidin-4-yl)propane-1,3-diamine, with the CAS number 915882-06-3, is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a methyl and propyl group, along with a propane backbone featuring two amine functional groups. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the pyrimidine moiety may also impart specific biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the pyrimidine ring and the amine groups. Overall, this compound represents a class of organic molecules that may have significant implications in various chemical and biological contexts.

Formula: C₁₁H₂₀N₄

InChI: InChI=1/C11H20N4/c1-3-5-10-14-9(2)8-11(15-10)13-7-4-6-12/h8H,3-7,12H2,1-2H3,(H,13,14,15)

SMILES: CCCc1nc(C)cc(=NCCCN)[nH]1

(3-aminopropyl)(6-methyl-2-propyl-4-pyrimidinyl)amine

CAS: 915882-06-3

Formula: C₁₁H₂₀N₄

Purity: 95.0%

Molecular weight: 208.309

Ref: 10-F315708