CAS 915893-84-4

[2,2-dimethyl-4-(2-methylphenyl)tetrahydro-2H-pyran-4-yl]acetic acid

Description:

[2,2-Dimethyl-4-(2-methylphenyl)tetrahydro-2H-pyran-4-yl]acetic acid is a chemical compound characterized by its complex structure, which includes a tetrahydropyran ring and an acetic acid functional group. This compound features a dimethyl substitution at the 2-position and a 2-methylphenyl group at the 4-position of the tetrahydropyran ring, contributing to its unique properties. It is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic component, while the acetic acid moiety may impart some polar characteristics. The presence of multiple functional groups suggests potential for various chemical reactivity, including esterification and amidation. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. Its molecular structure can influence its physical properties, such as melting point and boiling point, as well as its interaction with biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.

Formula: C₁₆H₂₂O₃

InChI: InChI=1/C16H22O3/c1-12-6-4-5-7-13(12)16(10-14(17)18)8-9-19-15(2,3)11-16/h4-7H,8-11H2,1-3H3,(H,17,18)

SMILES: Cc1ccccc1C1(CCOC(C)(C)C1)CC(=O)O